Leukotriene B3 (LTB3)
Modify Date: 2025-08-24 10:23:37
Leukotriene B3 (LTB3) structure
|
Common Name | Leukotriene B3 (LTB3) | ||
|---|---|---|---|---|
| CAS Number | 88099-35-8 | Molecular Weight | 338.482 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 525.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9±26.6 °C | |
Use of Leukotriene B3 (LTB3)LTB3 is the LTA hydrolase metabolite of LTA3 in the leukotriene biosynthetic pathway. |
| Name | leukotriene b3 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.9±50.0 °C at 760 mmHg |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.482 |
| Flash Point | 285.9±26.6 °C |
| Exact Mass | 338.245697 |
| PSA | 77.76000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | NGTXCORNXNELNU-JSHWEIDYSA-N |
| SMILES | CCCCCCCCC(O)C=CC=CC=CC(O)CCCC(=O)O |
| (5R,6E,8Z,10E,12S)-5,12-Dihydroxy-6,8,10-icosatrienoic acid |
| ltb3 |
| 5s,12r-dihydroxy-6z,8e,10e-eicosatrienoic acid |
| 6,8,10-Eicosatrienoic acid, 5,12-dihydroxy-, (5R,6E,8Z,10E,12S)- |