1-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]prop-1-en-2-amine
Modify Date: 2025-08-25 15:42:36
![1-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]prop-1-en-2-amine Structure](https://image.chemsrc.com/caspic/444/88090-93-1.png)
1-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]prop-1-en-2-amine structure
|
Common Name | 1-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]prop-1-en-2-amine | ||
|---|---|---|---|---|
| CAS Number | 88090-93-1 | Molecular Weight | 251.73500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]prop-1-en-2-amine |
|---|
| Molecular Formula | C11H10ClN3S |
|---|---|
| Molecular Weight | 251.73500 |
| Exact Mass | 251.02800 |
| PSA | 80.04000 |
| LogP | 3.87830 |
| InChIKey | DEDUCDQJCYBZPO-UHFFFAOYSA-N |
| SMILES | CC(N)=Cc1nc(-c2ccc(Cl)cc2)ns1 |
|
~%
1-[3-(4-chlorop... CAS#:88090-93-1 |
| Literature: Ohkata, Katsuo; Ohyama, Yoshihiko; Watanabe, Yuko; Akiba, Kin-ya Tetrahedron Letters, 1984 , vol. 25, # 40 p. 4561 - 4564 |
|
~%
1-[3-(4-chlorop... CAS#:88090-93-1 |
| Literature: Ohkata, Katsuo; Ohyama, Yoshihiko; Watanabe, Yuko; Akiba, Kin-ya Tetrahedron Letters, 1984 , vol. 25, # 40 p. 4561 - 4564 |
|
~%
1-[3-(4-chlorop... CAS#:88090-93-1 |
| Literature: Akiba, Kin-Ya; Noda, Akiko; Ohkata, Katsuo Phosphorus and Sulfur and the Related Elements, 1983 , vol. 16, p. 111 - 118 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |