4-[3,3-bis(benzenesulfonyl)propyl]morpholine structure
|
Common Name | 4-[3,3-bis(benzenesulfonyl)propyl]morpholine | ||
|---|---|---|---|---|
| CAS Number | 88089-99-0 | Molecular Weight | 409.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3,3-bis(benzenesulfonyl)propyl]morpholine |
|---|
| Molecular Formula | C19H23NO5S2 |
|---|---|
| Molecular Weight | 409.52000 |
| Exact Mass | 409.10200 |
| PSA | 97.51000 |
| LogP | 4.08210 |
| InChIKey | OIRFWTQNAWOFEG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(CCN1CCOCC1)S(=O)(=O)c1ccccc1 |
|
~81%
4-[3,3-bis(benz... CAS#:88089-99-0 |
| Literature: Li, Chuen; Sammes, Michael P. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2193 - 2196 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |