2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile
2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile structure
|
Common Name | 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 88075-93-8 | Molecular Weight | 210.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N2O |
|---|---|
| Molecular Weight | 210.23100 |
| Exact Mass | 210.07900 |
| PSA | 45.79000 |
| LogP | 2.46988 |
| InChIKey | FSCDHZLOIZRECD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C#N)c(-n2ccc(C=O)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~64%
2-(3-formylpyrr... CAS#:88075-93-8 |
| Literature: Hamdan, Ali; Wasley, Jan W. F. Synthetic Communications, 1983 , vol. 13, # 9 p. 741 - 744 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: Molecular weight of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is 210.23100. |
| Q: What is the polar surface area (PSA) of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: Polar surface area (PSA) of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is 45.79000. |
| Q: What is the LogP of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: LogP of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is 2.46988. |
| Q: What is the molecular formula of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: Molecular formula of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is C13H10N2O. |
| Q: What is the English name of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: The English name of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile. |
| Q: What are the upstream materials of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: Related upstream materials(CAS) of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile: 50634-05-4;26830-96-6. |
| Q: What is the CAS number of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: CAS number of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is 88075-93-8. |
| Q: What is the Chinese name of 88075-93-8? |
| A: Chinese name of 88075-93-8 is 88075-93-8. |
| Q: What is the InChIKey of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: InChIKey of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is FSCDHZLOIZRECD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile? |
| A: SMILES notation of 2-(3-formylpyrrol-1-yl)-4-methylbenzonitrile is Cc1ccc(C#N)c(-n2ccc(C=O)c2)c1. |