1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde
1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde structure
|
Common Name | 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 88075-90-5 | Molecular Weight | 261.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO4 |
|---|---|
| Molecular Weight | 261.27300 |
| Exact Mass | 261.10000 |
| PSA | 49.69000 |
| LogP | 2.31560 |
| InChIKey | ZTBXPJWZIUTWPA-UHFFFAOYSA-N |
| SMILES | COc1cc(-n2ccc(C=O)c2)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~65%
1-(3,4,5-trimet... CAS#:88075-90-5 |
| Literature: Hamdan, Ali; Wasley, Jan W. F. Synthetic Communications, 1983 , vol. 13, # 9 p. 741 - 744 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Molecular formula of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is C14H15NO4. |
| Q: What is the InChIKey of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: InChIKey of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is ZTBXPJWZIUTWPA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 88075-90-5? |
| A: Chinese name of 88075-90-5 is 88075-90-5. |
| Q: What is the polar surface area (PSA) of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Polar surface area (PSA) of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is 49.69000. |
| Q: What is the molecular weight of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Molecular weight of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is 261.27300. |
| Q: What is the SMILES notation of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: SMILES notation of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is COc1cc(-n2ccc(C=O)c2)cc(OC)c1OC. |
| Q: What are the upstream materials of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: Related upstream materials(CAS) of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde: 50634-05-4;24313-88-0. |
| Q: What is the LogP of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: LogP of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is 2.31560. |
| Q: What is the CAS number of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: CAS number of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is 88075-90-5. |
| Q: What is the English name of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde? |
| A: The English name of 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde is 1-(3,4,5-trimethoxyphenyl)pyrrole-3-carbaldehyde. |