N-(1-chloroprop-1-enyl)-N,N'-bis(2-methoxyphenyl)propanimidamide
Modify Date: 2024-02-18 19:13:28
N-(1-chloroprop-1-enyl)-N,N'-bis(2-methoxyphenyl)propanimidamide structure
|
Common Name | N-(1-chloroprop-1-enyl)-N,N'-bis(2-methoxyphenyl)propanimidamide | ||
|---|---|---|---|---|
| CAS Number | 88046-85-9 | Molecular Weight | 358.86200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-chloroprop-1-enyl)-N,N'-bis(2-methoxyphenyl)propanimidamide |
|---|
| Molecular Formula | C20H23ClN2O2 |
|---|---|
| Molecular Weight | 358.86200 |
| Exact Mass | 358.14500 |
| PSA | 34.06000 |
| LogP | 5.75050 |
|
~71%
N-(1-chloroprop... CAS#:88046-85-9 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |