N-(1-chloroethenyl)-N,N'-bis(3-methylphenyl)ethanimidamide structure
|
Common Name | N-(1-chloroethenyl)-N,N'-bis(3-methylphenyl)ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 88046-80-4 | Molecular Weight | 298.81000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-chloroethenyl)-N,N'-bis(3-methylphenyl)ethanimidamide |
|---|
| Molecular Formula | C18H19ClN2 |
|---|---|
| Molecular Weight | 298.81000 |
| Exact Mass | 298.12400 |
| PSA | 15.60000 |
| LogP | 5.56990 |
| InChIKey | CWDAGFRVZRHBEO-UHFFFAOYSA-N |
| SMILES | C=C(Cl)N(C(C)=Nc1cccc(C)c1)c1cccc(C)c1 |
|
~57%
N-(1-chloroethe... CAS#:88046-80-4 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |