1,4,4,6-tetramethylpyridine-2,3,5-tricarbonitrile
Modify Date: 2025-08-26 16:19:48
1,4,4,6-tetramethylpyridine-2,3,5-tricarbonitrile structure
|
Common Name | 1,4,4,6-tetramethylpyridine-2,3,5-tricarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 88014-24-8 | Molecular Weight | 212.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4,4,6-tetramethylpyridine-2,3,5-tricarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N4 |
|---|---|
| Molecular Weight | 212.25000 |
| Exact Mass | 212.10600 |
| PSA | 74.61000 |
| LogP | 1.99474 |
| InChIKey | PZGQVIIFRYXJTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C#N)C(C)(C)C(C#N)=C(C#N)N1C |
|
~58%
1,4,4,6-tetrame... CAS#:88014-24-8 |
| Literature: Kurfuerst, Antonin; Kuthan, Josef Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 6 p. 1718 - 1728 |
|
~%
1,4,4,6-tetrame... CAS#:88014-24-8 |
| Literature: Kurfuerst, Antonin; Schwarz, Marian Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 5 p. 1346 - 1357 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,5-Pyridinetricarbonitrile,1,4-dihydro-1,4,4,6-tetramethyl |