2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]naphthalene-1,4-dione
Modify Date: 2025-11-29 17:17:14
![2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]naphthalene-1,4-dione Structure](https://image.chemsrc.com/caspic/435/88007-99-2.png)
2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]naphthalene-1,4-dione structure
|
Common Name | 2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 88007-99-2 | Molecular Weight | 335.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-[2-(4-nitrophenyl)-2-oxoethyl]naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13NO5 |
|---|---|
| Molecular Weight | 335.31000 |
| Exact Mass | 335.07900 |
| PSA | 97.03000 |
| LogP | 4.08650 |
| InChIKey | HOUITNAJHFPESJ-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=O)c2ccc([N+](=O)[O-])cc2)C(=O)c2ccccc2C1=O |
|
~87%
2-methyl-3-[2-(... CAS#:88007-99-2 |
| Literature: Aldersley, Michael F.; Dean, Francis M.; Nayyir-Mazhir, Rassoul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1753 - 1757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 11e-906 |