(5-nitrofuran-2-yl)imino-triphenyl-λ5-phosphane structure
|
Common Name | (5-nitrofuran-2-yl)imino-triphenyl-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 87997-17-9 | Molecular Weight | 388.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-nitrofuran-2-yl)imino-triphenyl-λ5-phosphane |
|---|
| Molecular Formula | C22H17N2O3P |
|---|---|
| Molecular Weight | 388.35600 |
| Exact Mass | 388.09800 |
| PSA | 81.13000 |
| LogP | 5.52020 |
| InChIKey | UTUKMSYHPLXNHR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)o1 |
|
~98%
(5-nitrofuran-2... CAS#:87997-17-9 |
| Literature: Vegh, Daniel; Kovac, Jaroslav; Dandarova, Miloslava Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 7 p. 1885 - 1890 |
|
~%
(5-nitrofuran-2... CAS#:87997-17-9 |
| Literature: Vegh, Daniel; Kovac, Jaroslav; Dandarova, Miloslava Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 7 p. 1885 - 1890 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |