2'-chloro-4-trifluoromethoxybenzophenone structure
|
Common Name | 2'-chloro-4-trifluoromethoxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 87996-54-1 | Molecular Weight | 300.66000 | |
| Density | 1.367g/cm3 | Boiling Point | 342.6ºC at 760mmHg | |
| Molecular Formula | C14H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.2ºC | |
| Name | (2-chlorophenyl)-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 342.6ºC at 760mmHg |
| Molecular Formula | C14H8ClF3O2 |
| Molecular Weight | 300.66000 |
| Flash Point | 131.2ºC |
| Exact Mass | 300.01600 |
| PSA | 26.30000 |
| LogP | 4.46960 |
| Index of Refraction | 1.531 |
| InChIKey | XUMDUKMAADXRGL-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)c1ccccc1Cl |
| HS Code | 2914700090 |
|---|
|
~90%
2'-chloro-4-tri... CAS#:87996-54-1 |
| Literature: Desbois, Michel Bulletin de la Societe Chimique de France, 1986 , # 6 p. 885 - 890 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-trifluoromethoxy-2'-chlorobenzophenone |
| EINECS 289-366-2 |
| 2'-Chloro-4-trifluoromethoxybenzophenone |
| trifluoromethoxy-4 chloro-2' benzophenone |