4-[4,5-dihydro-4-(4-methoxybenzylidene)-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with triethylamine (1:1) structure
|
Common Name | 4-[4,5-dihydro-4-(4-methoxybenzylidene)-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 87980-32-3 | Molecular Weight | 473.58500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H31N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethylethanamine,4-[(4E)-4-[(4-methoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H31N3O5S |
|---|---|
| Molecular Weight | 473.58500 |
| Exact Mass | 473.19800 |
| PSA | 107.89000 |
| LogP | 4.67750 |
| InChIKey | APPDAJQIVQJKRF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.COc1ccc(C=C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C)cc1 |
| einecs 289-361-5 |