4-[4-[(3,4-dimethoxyphenyl)methylene]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with triethylamine (1:1) structure
|
Common Name | 4-[4-[(3,4-dimethoxyphenyl)methylene]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonic acid, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 87980-30-1 | Molecular Weight | 503.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H33N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethylethanamine,4-[(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-3-methyl-5-oxopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H33N3O6S |
|---|---|
| Molecular Weight | 503.61100 |
| Exact Mass | 503.20900 |
| PSA | 117.12000 |
| LogP | 4.68610 |
| InChIKey | QGTXWYFALBBOJT-QFHYWFJHSA-N |
| SMILES | CCN(CC)CC.COc1ccc(C=C2C(=O)N(c3ccc(S(=O)(=O)O)cc3)N=C2C)cc1OC |
| einecs 289-359-4 |