N-[1-(3-nitrophenyl)ethylidene]hydroxylamine
Modify Date: 2025-09-16 17:33:02
![N-[1-(3-nitrophenyl)ethylidene]hydroxylamine Structure](https://image.chemsrc.com/caspic/245/87974-55-8.png)
N-[1-(3-nitrophenyl)ethylidene]hydroxylamine structure
|
Common Name | N-[1-(3-nitrophenyl)ethylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 87974-55-8 | Molecular Weight | 180.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(3-nitrophenyl)ethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O3 |
|---|---|
| Molecular Weight | 180.16100 |
| Exact Mass | 180.05300 |
| PSA | 78.41000 |
| LogP | 2.31620 |
| InChIKey | PDRKZXUNOXCETR-UHFFFAOYSA-N |
| SMILES | CC(=NO)c1cccc([N+](=O)[O-])c1 |
|
~%
N-[1-(3-nitroph... CAS#:87974-55-8 |
| Literature: Badal, Mizanur Rahman; Mishima, Masaaki Bulletin of the Chemical Society of Japan, 2010 , vol. 83, # 1 p. 58 - 65 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:122-28-1| 3-nitroacetophenone oxime |
| m-Nitroacetophenonoxime |