2-chloro-3-prop-2-enylnaphthalene-1,4-dione
Modify Date: 2025-09-12 11:57:47
2-chloro-3-prop-2-enylnaphthalene-1,4-dione structure
|
Common Name | 2-chloro-3-prop-2-enylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 87971-47-9 | Molecular Weight | 232.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3-prop-2-enylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9ClO2 |
|---|---|
| Molecular Weight | 232.66200 |
| Exact Mass | 232.02900 |
| PSA | 34.14000 |
| LogP | 3.13460 |
| InChIKey | CVPBOGYQGOBSHM-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(Cl)C(=O)c2ccccc2C1=O |
|
~30%
2-chloro-3-prop... CAS#:87971-47-9 |
| Literature: Peet, William G.; Tam, Wilson Journal of the Chemical Society, Chemical Communications, 1983 , # 15 p. 853 - 854 |
|
~33%
2-chloro-3-prop... CAS#:87971-47-9 |
| Literature: Maruyama, Kazuhiro; Imahori, Hiroshi; Osuka, Atsuhiro; Takuwa, Akio; Tagawa, Hiroyuki Chemistry Letters, 1986 , p. 1719 - 1722 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-allyl-3-chloronaphthoquinone |
| 2-allyl-3-chloro-1,4-naphthoquinone |