3-amino-3-hydroxy-6-oxocyclohexa-1,4-diene-1,2-dicarbonitrile structure
|
Common Name | 3-amino-3-hydroxy-6-oxocyclohexa-1,4-diene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 87963-46-0 | Molecular Weight | 175.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-3-hydroxy-6-oxocyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5N3O2 |
|---|---|
| Molecular Weight | 175.14400 |
| Exact Mass | 175.03800 |
| PSA | 110.90000 |
| InChIKey | WGYJZMUUDVAUDP-UHFFFAOYSA-N |
| SMILES | N#CC1=C(C#N)C(N)(O)C=CC1=O |
|
~%
3-amino-3-hydro... CAS#:87963-46-0 |
| Literature: Chudek, John A.; Foster, Roy; Reid, Francis J. Journal of the Chemical Society, Chemical Communications, 1983 , # 13 p. 726 - 727 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Cyclohexadiene-1,2-dicarbonitrile,3-amino-3-hydroxy-6-oxo |