(3-ACETYL-7-ETHYL-INDOL-1-YL)-ACETIC ACID structure
|
Common Name | (3-ACETYL-7-ETHYL-INDOL-1-YL)-ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 879053-36-8 | Molecular Weight | 238.28000 | |
| Density | 1.164g/cm3 | Boiling Point | 427ºC at 760 mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.7ºC | |
| Name | 4-hydroxy-4-(4-methoxy-2,5-dimethylphenyl)butanoic acid |
|---|
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 427ºC at 760 mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28000 |
| Flash Point | 161.7ºC |
| Exact Mass | 238.12100 |
| PSA | 66.76000 |
| LogP | 2.21020 |
| Index of Refraction | 1.542 |
| InChIKey | CVXGRCQCQPJBTG-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(C(O)CCC(=O)O)cc1C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |