2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one structure
|
Common Name | 2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one | ||
|---|---|---|---|---|
| CAS Number | 879034-73-8 | Molecular Weight | 179.17900 | |
| Density | 1.69g/cm3 | Boiling Point | 302.3ºC at 760 mmHg | |
| Molecular Formula | C7H9N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6ºC | |
| Name | 2-amino-5,6-dimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 302.3ºC at 760 mmHg |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.17900 |
| Flash Point | 136.6ºC |
| Exact Mass | 179.08100 |
| PSA | 89.07000 |
| LogP | 0.19780 |
| Index of Refraction | 1.803 |
| InChIKey | VFXLDXXGTGVXAX-UHFFFAOYSA-N |
| SMILES | Cc1nc2nc(N)[nH]n2c(=O)c1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |