7-hydroxy-2-methyl-3-phenoxychromen-4-one structure
|
Common Name | 7-hydroxy-2-methyl-3-phenoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 87891-62-1 | Molecular Weight | 268.26400 | |
| Density | 1.334g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.1ºC | |
| Name | 7-hydroxy-2-methyl-3-phenoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 163.1ºC |
| Exact Mass | 268.07400 |
| PSA | 59.67000 |
| LogP | 3.59930 |
| Index of Refraction | 1.642 |
| InChIKey | WGDLKKMGZLAZSL-UHFFFAOYSA-N |
| SMILES | Cc1oc2cc(O)ccc2c(=O)c1Oc1ccccc1 |
| HS Code | 2914509090 |
|---|
|
~72%
7-hydroxy-2-met... CAS#:87891-62-1 |
| Literature: Vasil'ev, S. A.; Luk'yanchikov, M. S.; Molchanov, G. I.; Turubarov, V. D.; Khilya, V. P. Pharmaceutical Chemistry Journal, 1991 , vol. 25, # 7 p. 470 - 475 Khimiko-Farmatsevticheskii Zhurnal, 1991 , vol. 25, # 7 p. 34 - 38 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4H-1-Benzopyran-4-one,7-hydroxy-2-methyl-3-phenoxy |
| 2-Methyl-3-phenoxy-7-hydroxychromone |
| 7-hydroxy-2-methyl-3-phenoxy-4H-chromen-4-one |
| 7-Hydroxy-2-methyl-3-phenoxy-4H-1-benzopyran-4-one |