chloro-[2-[2-[chloro(dimethyl)silyl]phenyl]phenyl]-dimethylsilane structure
|
Common Name | chloro-[2-[2-[chloro(dimethyl)silyl]phenyl]phenyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 87842-18-0 | Molecular Weight | 339.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20Cl2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-[2-[2-[chloro(dimethyl)silyl]phenyl]phenyl]-dimethylsilane |
|---|
| Molecular Formula | C16H20Cl2Si2 |
|---|---|
| Molecular Weight | 339.40700 |
| Exact Mass | 338.04800 |
| LogP | 4.65540 |
| InChIKey | OCLVZAAYJKXSQR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)c1ccccc1-c1ccccc1[Si](C)(C)Cl |
|
~32%
chloro-[2-[2-[c... CAS#:87842-18-0 |
| Literature: Sakurai, Hideki; Sakamoto, Kenkichi; Kira, Mitsuo Chemistry Letters, 1984 , p. 1213 - 1214 |
|
~%
chloro-[2-[2-[c... CAS#:87842-18-0 |
| Literature: Kira,M.; Sakamoto,K.; Sakurai,H. Journal of the American Chemical Society, 1983 , vol. 105, p. 7469 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |