dimethyl 2-[1-(furan-2-yl)prop-2-enyl]-2-methylpropanedioate structure
|
Common Name | dimethyl 2-[1-(furan-2-yl)prop-2-enyl]-2-methylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 87802-88-8 | Molecular Weight | 252.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-[1-(furan-2-yl)prop-2-enyl]-2-methylpropanedioate |
|---|
| Molecular Formula | C13H16O5 |
|---|---|
| Molecular Weight | 252.26300 |
| Exact Mass | 252.10000 |
| PSA | 65.74000 |
| LogP | 1.90150 |
| InChIKey | GJIHIZLXJUACSR-UHFFFAOYSA-N |
| SMILES | C=CC(c1ccco1)C(C)(C(=O)OC)C(=O)OC |
|
~88%
dimethyl 2-[1-(... CAS#:87802-88-8 |
| Literature: Trost, Barry M.; Hung, Ming-Hong Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7757 - 7759 |
|
~%
dimethyl 2-[1-(... CAS#:87802-88-8
Detail
|
| Literature: Trost, Barry M.; Merlic, Craig A. Journal of the American Chemical Society, 1990 , vol. 112, # 26 p. 9590 - 9600 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |