3-(2-phenylselanylprop-2-enyl)thiophene structure
|
Common Name | 3-(2-phenylselanylprop-2-enyl)thiophene | ||
|---|---|---|---|---|
| CAS Number | 87728-83-4 | Molecular Weight | 279.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12SSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-phenylselanylprop-2-enyl)thiophene |
|---|
| Molecular Formula | C13H12SSe |
|---|---|
| Molecular Weight | 279.25900 |
| Exact Mass | 279.98200 |
| PSA | 28.24000 |
| LogP | 2.83400 |
| InChIKey | GDSXBVVIXMDYEG-UHFFFAOYSA-N |
| SMILES | C=C(Cc1ccsc1)[Se]c1ccccc1 |
|
~%
3-(2-phenylsela... CAS#:87728-83-4 |
| Literature: Halazy, Serge; Hevesi, Laszlo Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5242 - 5246 |
|
~%
3-(2-phenylsela... CAS#:87728-83-4 |
| Literature: Halazy, Serge; Hevesi, Laszlo Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5242 - 5246 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |