1-methyl-2-(2-phenylselanylprop-2-enyl)pyrrole structure
|
Common Name | 1-methyl-2-(2-phenylselanylprop-2-enyl)pyrrole | ||
|---|---|---|---|---|
| CAS Number | 87728-78-7 | Molecular Weight | 276.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-(2-phenylselanylprop-2-enyl)pyrrole |
|---|
| Molecular Formula | C14H15NSe |
|---|---|
| Molecular Weight | 276.23600 |
| Exact Mass | 277.03700 |
| PSA | 4.93000 |
| LogP | 2.11100 |
| InChIKey | ASLTWPAIEOFFSW-UHFFFAOYSA-N |
| SMILES | C=C(Cc1cccn1C)[Se]c1ccccc1 |
|
~%
1-methyl-2-(2-p... CAS#:87728-78-7 |
| Literature: Halazy, Serge; Hevesi, Laszlo Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5242 - 5246 |
|
~%
1-methyl-2-(2-p... CAS#:87728-78-7 |
| Literature: Halazy, Serge; Hevesi, Laszlo Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5242 - 5246 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |