3-trimethylsilylhepta-1,2,5-trien-4-ol structure
|
Common Name | 3-trimethylsilylhepta-1,2,5-trien-4-ol | ||
|---|---|---|---|---|
| CAS Number | 87655-77-4 | Molecular Weight | 182.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-trimethylsilylhepta-1,2,5-trien-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18OSi |
|---|---|
| Molecular Weight | 182.33500 |
| Exact Mass | 182.11300 |
| PSA | 20.23000 |
| LogP | 2.51210 |
| InChIKey | ODQOMMRZYHBBNE-UHFFFAOYSA-N |
| SMILES | C=C=C(C(O)C=CC)[Si](C)(C)C |
|
~%
3-trimethylsily... CAS#:87655-77-4 |
| Literature: Mesnard, Danielle; Miginiac, Leone Journal of Organometallic Chemistry, 1992 , vol. 440, # 3 p. 277 - 287 |
|
~%
3-trimethylsily... CAS#:87655-77-4 |
| Literature: Wang, Kung K.; Nikam, Sham S.; Ho, Chihmei D. Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5376 - 5377 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (+/-)-(E)-3-(trimethylsilyl)-1,2,5-heptatrien-4-ol |
| 1,2,5-Heptatrien-4-ol,3-(trimethylsilyl)-,(E) |