Ethyl 3-bromo-4-ethoxybenzoate
Modify Date: 2025-08-28 22:09:47
Ethyl 3-bromo-4-ethoxybenzoate structure
|
Common Name | Ethyl 3-bromo-4-ethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 875846-59-6 | Molecular Weight | 273.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-bromo-4-ethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13BrO3 |
|---|---|
| Molecular Weight | 273.12300 |
| Exact Mass | 272.00500 |
| PSA | 35.53000 |
| LogP | 3.02450 |
| InChIKey | YXYDMAQNGIXRBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCC)c(Br)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl 3-bromo-4... CAS#:875846-59-6 |
| Literature: Branch; Jones Journal of the Chemical Society, 1955 , p. 2921,2922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Aethoxy-3-brom-benzoesaeure-aethylester |
| 3-Brom-4-ethoxy-ethyl-benzoat |
| 4-ethoxy-3-bromo-benzoic acid ethyl ester |