1,5-Diphenyl-3-(1H-indol-3-yl)formazan
Modify Date: 2025-09-13 18:01:14
1,5-Diphenyl-3-(1H-indol-3-yl)formazan structure
|
Common Name | 1,5-Diphenyl-3-(1H-indol-3-yl)formazan | ||
|---|---|---|---|---|
| CAS Number | 87582-33-0 | Molecular Weight | 339.39300 | |
| Density | 1.21g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C21H17N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 1-[indol-3-ylidene(phenyldiazenyl)methyl]-2-phenylhydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.39300 |
| Flash Point | 225.7ºC |
| Exact Mass | 339.14800 |
| PSA | 61.14000 |
| LogP | 5.37120 |
| Index of Refraction | 1.668 |
| InChIKey | PLXLITZUXZPTFP-GIMNODSFSA-N |
| SMILES | c1ccc(N=NC(=NNc2ccccc2)c2c[nH]c3ccccc23)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
1,5-Diphenyl-3-... CAS#:87582-33-0 |
| Literature: Sathi; Gujrati; Nath; Agarwal; Bhargava; Shanker Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 9 p. 1218 - 1221 |
|
~%
1,5-Diphenyl-3-... CAS#:87582-33-0 |
| Literature: Sathi; Gujrati; Nath; Agarwal; Bhargava; Shanker Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 9 p. 1218 - 1221 |
|
~%
1,5-Diphenyl-3-... CAS#:87582-33-0 |
| Literature: Sathi; Gujrati; Nath; Agarwal; Bhargava; Shanker Arzneimittel-Forschung/Drug Research, 1983 , vol. 33, # 9 p. 1218 - 1221 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole,3-[(phenylazo)(phenylhydrazono)methyl]-(9CI) |
| Formazan,3-(1H-indol-3-yl)-1,5-diphenyl |
| 1-[(E)-indol-3-ylidene(phenyldiazenyl)methyl]-2-phenylhydrazine |
| 1,5-Diphenyl-3-(1H-indol-3-yl)formazan |
| 1-phenyl-3-(3'-indole)-5-phenyl formazan |
| Methanone,1H-indol-3-yl(2-phenyldiazenyl)-,2-phenylhydrazone |