methyl N-[4-[3-[(4-chlorophenyl)carbamoyl]oxazolidin-2-yl]phenyl]carbamate
Modify Date: 2024-02-01 18:43:25
![methyl N-[4-[3-[(4-chlorophenyl)carbamoyl]oxazolidin-2-yl]phenyl]carbamate Structure](https://image.chemsrc.com/caspic/088/87537-63-1.png)
methyl N-[4-[3-[(4-chlorophenyl)carbamoyl]oxazolidin-2-yl]phenyl]carbamate structure
|
Common Name | methyl N-[4-[3-[(4-chlorophenyl)carbamoyl]oxazolidin-2-yl]phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 87537-63-1 | Molecular Weight | 375.80600 | |
| Density | 1.418g/cm3 | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C18H18ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
| Name | methyl N-[4-[3-[(4-chlorophenyl)carbamoyl]-1,3-oxazolidin-2-yl]phenyl]carbamate |
|---|
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760 mmHg |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.80600 |
| Flash Point | 293.5ºC |
| Exact Mass | 375.09900 |
| PSA | 79.90000 |
| LogP | 4.16510 |
| Index of Refraction | 1.662 |
| InChIKey | ZFOGLZPGYBOJQI-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1ccc(C2OCCN2C(=O)Nc2ccc(Cl)cc2)cc1 |
|
~82%
methyl N-[4-[3-... CAS#:87537-63-1 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 10 p. 2025 - 2030 |
|
~%
methyl N-[4-[3-... CAS#:87537-63-1 |
| Literature: Witek, Stanislaw; Bielawska, Alicja; Bielawski, Jacek Polish Journal of Chemistry, 1981 , vol. 55, # 10 p. 2025 - 2030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |