4-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine structure
|
Common Name | 4-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 875340-50-4 | Molecular Weight | 229.66500 | |
| Density | 1.387g/cm3 | Boiling Point | 447.123ºC at 760 mmHg | |
| Molecular Formula | C12H8ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.754ºC | |
| Name | 4-chloro-6-phenyl-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 447.123ºC at 760 mmHg |
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.66500 |
| Flash Point | 256.754ºC |
| Exact Mass | 229.04100 |
| PSA | 41.57000 |
| LogP | 3.27830 |
| Index of Refraction | 1.703 |
| InChIKey | ADQVKUWGTSOSDV-UHFFFAOYSA-N |
| SMILES | Clc1ncnc2cc(-c3ccccc3)[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~74%
4-chloro-6-phen... CAS#:875340-50-4 |
| Literature: METHYLGENE, INC. Patent: WO2006/10264 A1, 2006 ; Location in patent: Page/Page column 195-196 ; WO 2006/010264 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5H-Pyrrolo[3,2-d]pyrimidine,4-chloro-6-phenyl |