Roridin A, 8-hydroxy-9B,10B-epoxy- structure
|
Common Name | Roridin A, 8-hydroxy-9B,10B-epoxy- | ||
|---|---|---|---|---|
| CAS Number | 87532-31-8 | Molecular Weight | 564.62100 | |
| Density | 1.39g/cm3 | Boiling Point | 807.3ºC at 760 mmHg | |
| Molecular Formula | C29H40O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.7ºC | |
| Name | Verrucarin A, 7'-deoxo-9,10-epoxy-9,10-dihydro-8-hydroxy-7'-(1-hydro ethyl)-, (8.β.,9.β.,10.β.) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 807.3ºC at 760 mmHg |
| Molecular Formula | C29H40O11 |
| Molecular Weight | 564.62100 |
| Flash Point | 264.7ºC |
| Exact Mass | 564.25700 |
| PSA | 156.81000 |
| LogP | 0.57540 |
| Index of Refraction | 1.601 |
| InChIKey | DYIWWIJYZCGJAG-XOHHJFHKSA-N |
| SMILES | CC(O)C1C=CC=CC(=O)OC2CC3OC4C5OC5(C)C(O)CC4(COC(=O)C(O)C(C)CCO1)C2(C)C31CO1 |
|
~57%
Roridin A, 8-hy... CAS#:87532-31-8 |
| Literature: Jarvis, Bruce B.; Midiwo, Jacob O.; Mazzola, Eugene P. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 239 - 244 |
|
~%
Roridin A, 8-hy... CAS#:87532-31-8 |
| Literature: Jarvis, Bruce B.; Midiwo, Jacob O.; Mazzola, Eugene P. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 239 - 244 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-((2-(Diethylamino)ethyl)thio)caffeine hydrochloride |
| diethyl-[2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylethyl]azanium chloride |
| CAFFEINE,8-((2-(DIETHYLAMINO)ETHYL)THIO)-,HYDROCHLORIDE |