(2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Modify Date: 2024-04-08 00:07:52
![(2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol Structure](https://image.chemsrc.com/caspic/348/87508-18-7.png)
(2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol structure
|
Common Name | (2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol | ||
|---|---|---|---|---|
| CAS Number | 87508-18-7 | Molecular Weight | 360.42 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 581.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3±30.1 °C | |
Use of (2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diolDescription This is a protected galactopyranoside useful as a building block for synthesis of complex carbohydrates. The compound has β-phenylthio and 4,6-benzylidine protecting groups. Description This is a protected galactopyranoside useful as a building block for synthesis of complex carbohydrates. The compound has β-phenylthio and 4,6-benzylidine protecting groups. |
| Name | (2S,4aR,6S,7R,8R,8aR)-2-phenyl-6-(phenylthio)hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.2±50.0 °C at 760 mmHg |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.42 |
| Flash Point | 305.3±30.1 °C |
| Exact Mass | 360.103149 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | BDNIQCYVYFGHSI-VWQYPGANSA-N |
| SMILES | OC1C(Sc2ccccc2)OC2COC(c3ccccc3)OC2C1O |
| Phenyl 4,6-O-benzylidine-1-thio-β-D-galactoside |
| MFCD19980769 |