ethyl 4-amino-3-bromo-5-chlorobenzoate
Modify Date: 2025-09-22 07:02:00
ethyl 4-amino-3-bromo-5-chlorobenzoate structure
|
Common Name | ethyl 4-amino-3-bromo-5-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 874779-56-3 | Molecular Weight | 278.53000 | |
| Density | N/A | Boiling Point | 363.1°C at 760 mmHg | |
| Molecular Formula | C9H9BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-amino-3-bromo-5-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 363.1°C at 760 mmHg |
|---|---|
| Molecular Formula | C9H9BrClNO2 |
| Molecular Weight | 278.53000 |
| Exact Mass | 276.95100 |
| PSA | 52.32000 |
| LogP | 3.44260 |
| InChIKey | FQWOYQPBFUMLID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Cl)c(N)c(Br)c1 |
| HS Code | 2922499990 |
|---|
|
~94%
ethyl 4-amino-3... CAS#:874779-56-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2006/100009 A1, 2006 ; Location in patent: Page/Page column 135-136 ; WO 2006/100009 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:874779-57-4| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-amino-5-bromo-3-chlorobenzoic acid |
| 4-amino-3-bromo-5-chloro-benzoic acid |
| 4-amino-3-bromo-5-chloro-benzoic acid ethyl ester |