O-2545 (hydrochloride)
Modify Date: 2025-10-03 18:15:50
O-2545 (hydrochloride) structure
|
Common Name | O-2545 (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 874745-43-4 | Molecular Weight | 445.037 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H37ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of O-2545 (hydrochloride)O-2545 hydrochloride is a potent agonist of central cannabinoid (CB1) and peripheral cannabinoid (CB2) receptors with Ki values of 1.5 and 0.32 nM, respectively. |
| Name | (6aR,10aR)-3-[6-(1H-Imidazol-1-yl)-2-methyl-2-hexanyl]-6,6,9-trim ethyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol hydrochlorid e (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H37ClN2O2 |
|---|---|
| Molecular Weight | 445.037 |
| Exact Mass | 444.254364 |
| PSA | 47.28000 |
| LogP | 7.14970 |
| InChIKey | LSHUCXYFAOTXLT-MUCZFFFMSA-N |
| SMILES | CC1=CCC2C(C1)c1c(O)cc(C(C)(C)CCCCn3ccnc3)cc1OC2(C)C.Cl |
| 6H-Dibenzo[b,d]pyran-1-ol, 6a,7,10,10a-tetrahydro-3-[5-(1H-imidazol-1-yl)-1,1-dimethylpentyl]-6,6,9-trimethyl-, (6aR,10aR)-, hydrochloride (1:1) |
| (6aR,10aR)-3-[6-(1H-Imidazol-1-yl)-2-methylhexan-2-yl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol hydrochloride (1:1) |
| (6aR,10aR)-3-[6-(1H-Imidazol-1-yl)-2-methyl-2-hexanyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol hydrochloride (1:1) |