5-pyridin-1-yl-2,6-bis(trifluoromethyl)-5H-pyrimidin-4-one
Modify Date: 2025-09-09 22:27:15
5-pyridin-1-yl-2,6-bis(trifluoromethyl)-5H-pyrimidin-4-one structure
|
Common Name | 5-pyridin-1-yl-2,6-bis(trifluoromethyl)-5H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 87378-59-4 | Molecular Weight | 309.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5F6N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-oxo-2,6-bis(trifluoromethyl)-4,5-dihydropyrimidin-5-yl]pyridinium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H5F6N3O |
|---|---|
| Molecular Weight | 309.16700 |
| Exact Mass | 309.03400 |
| PSA | 50.18000 |
| LogP | 1.52480 |
| InChIKey | HABVPWJGSDMGNZ-UHFFFAOYSA-N |
| SMILES | O=C1N=C(C(F)(F)F)N=C(C(F)(F)F)C1N1C=CC=CC1 |
|
~%
5-pyridin-1-yl-... CAS#:87378-59-4 |
| Literature: Banks, Ronald E.; Pritchard, Robin G.; Thomson, Julie Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 1769 - 1776 |
![ethyl 2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylate structure](https://image.chemsrc.com/caspic/412/108438-46-6.png)
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:884-30-0| pyridinium 1-H-tetrafluoroethanesulfonate |
| Ethanesulfonic acid,1,2,2,2-tetrafluoro-,compd. with pyridine (1:1) |
| pyridinium 4,5-dihydro-4-oxo-2,6-bis(trifluoromethyl)pyrimidin-5-ylide |