2,3-bis(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane structure
|
Common Name | 2,3-bis(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 87338-21-4 | Molecular Weight | 358.42800 | |
| Density | 1.4g/cm3 | Boiling Point | 569.8ºC at 760 mmHg | |
| Molecular Formula | C12H22O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.4ºC | |
| Name | [3-(methylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decan-2-yl]methyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 569.8ºC at 760 mmHg |
| Molecular Formula | C12H22O8S2 |
| Molecular Weight | 358.42800 |
| Flash Point | 298.4ºC |
| Exact Mass | 358.07600 |
| PSA | 121.96000 |
| LogP | 2.54480 |
| Index of Refraction | 1.525 |
| InChIKey | LUAYJSOIHOTXSI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1OC2(CCCCC2)OC1COS(C)(=O)=O |
|
~97%
2,3-bis(methyls... CAS#:87338-21-4 |
| Literature: Sunkyong Industries, Ltd. Patent: US5395947 A1, 1995 ; |
|
~87%
2,3-bis(methyls... CAS#:87338-21-4 |
| Literature: Vriesema, Bindert K.; Buter, Jan; Kellogg, Richard M. Journal of Organic Chemistry, 1984 , vol. 49, # 1 p. 110 - 113 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3-O-Cyclohexyliden-L-threitol-1,4-bis-methansulfonat |