1-(2-Chloroethoxy)-3-nitrobenzene
Modify Date: 2025-09-18 10:45:34
1-(2-Chloroethoxy)-3-nitrobenzene structure
|
Common Name | 1-(2-Chloroethoxy)-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 87291-34-7 | Molecular Weight | 201.60700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-Chloroethoxy)-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8ClNO3 |
|---|---|
| Molecular Weight | 201.60700 |
| Exact Mass | 201.01900 |
| PSA | 55.05000 |
| LogP | 2.73560 |
| InChIKey | HZNHTVVNRCRLQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(OCCCl)c1 |
| HS Code | 2909309090 |
|---|
|
~78%
1-(2-Chloroetho... CAS#:87291-34-7 |
| Literature: Mewshaw, Richard E.; Husbands, Morris; Gildersleeve, Elizabeth S.; Webb, Michael B.; Shi, Xiaojie; Mazandarani, Hossein; Cockett, Mark I.; Ochalski, Rafal; Brennan, Julie A.; Abou-Gharbia, Magid; Marquis, Karen; McGaughey, Georgia B.; Coupet, Joseph; Andree, Terrance H. Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 3 p. 295 - 300 |
CAS#:26646-35-5
CAS#:178910-32-2| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (2-Chlor-aethyl)-(3-nitro-phenyl)-aether |
| MS-2653 |
| (2-chloro-ethyl)-(3-nitro-phenyl)-ether |