2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol structure
|
Common Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol | ||
|---|---|---|---|---|
| CAS Number | 87282-24-4 | Molecular Weight | 224.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H2F6N2O2 |
|---|---|
| Molecular Weight | 224.06100 |
| Exact Mass | 224.00200 |
| PSA | 65.18000 |
| InChIKey | FLGLZLBGJMMSCP-UHFFFAOYSA-N |
| SMILES | OC(O)(C(F)(F)F)C1(C(F)(F)F)N=N1 |
|
~%
2,2,2-trifluoro... CAS#:87282-24-4 |
| Literature: Laganis, E. D.; Janik, D. S.; Curphey, T. J.; Lemal, D. M. Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7457 - 7459 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1-Ethanediol,2,2,2-trifluoro-1-[3-(trifluoromethyl)-3H-diazirin-3-yl] |