Ramiprilat
Modify Date: 2025-08-21 11:07:43
Ramiprilat structure
|
Common Name | Ramiprilat | ||
|---|---|---|---|---|
| CAS Number | 87269-97-4 | Molecular Weight | 388.457 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 632.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H28N2O5 | Melting Point | 139-141ºC | |
| MSDS | N/A | Flash Point | 336.2±31.5 °C | |
Use of RamiprilatRamiprilat (HOE 498 diacid), an active metabolite of Ramipril, is a potent and orally active angiotensin converting enzyme (ACE) inhibitor with a Ki value of 7 pM. Ramiprilat can be used for high blood pressure and heart failure research[1]. |
| Name | Ramiprilat |
|---|---|
| Synonym | More Synonyms |
| Description | Ramiprilat (HOE 498 diacid), an active metabolite of Ramipril, is a potent and orally active angiotensin converting enzyme (ACE) inhibitor with a Ki value of 7 pM. Ramiprilat can be used for high blood pressure and heart failure research[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 632.2±55.0 °C at 760 mmHg |
| Melting Point | 139-141ºC |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.457 |
| Flash Point | 336.2±31.5 °C |
| Exact Mass | 388.199829 |
| PSA | 106.94000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | KEDYTOTWMPBSLG-HILJTLORSA-N |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1C(C(=O)O)CC2CCCC21 |
| Storage condition | Refrigerator, Under Inert Atmosphere |
|
~%
Ramiprilat CAS#:87269-97-4 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 40, # 8 p. 865 - 867 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 3004909090 |
|---|
| Ramiprilate [French] |
| Ramiprilate |
| (2S,3aS,6aS)-1-[(2S)-2-{[(1S)-1-Carboxy-3-phenylpropyl]amino}propanoyl]octahydrocyclopenta[b]pyrrole-2-carboxylic acid |
| 2-[N-((S)-1-carboxy-3-phenylpropyl)-L-alanyl]-(1S,3S,5S)-2-azabicyclo[3.3.0]octane-3-carboxylic acid |
| (2S,3aS,6aS)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| (2S,3aS,6aS)-1-((S)-N-((S)-1-Carboxy-3-phenylpropyl)alanyl)octahydrocyclopenta(b)pyrrole-2-carboxylic acid |
| Ramiprilatum |
| Ramiprilat [INN] |
| UNII-6N5U4QFC3G |
| Ramiprilat |
| Ramiprilatum [Latin] |