5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]hexahydro-4-(hydroxyMethyl)-(3aS,4S,5R,6aR)-2(1H)-pentalenone structure
|
Common Name | 5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]hexahydro-4-(hydroxyMethyl)-(3aS,4S,5R,6aR)-2(1H)-pentalenone | ||
|---|---|---|---|---|
| CAS Number | 871095-04-4 | Molecular Weight | 284.46700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2(1H)-Pentalenone, 5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]hexahydro-4-(hydroxymethyl)-, (3aS,4S,5R,6aR) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H28O3Si |
|---|---|
| Molecular Weight | 284.46700 |
| Exact Mass | 284.18100 |
| PSA | 46.53000 |
| LogP | 2.98430 |
| InChIKey | NJQFFQRSPNJART-SCUASFONSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2CC(=O)CC2C1CO |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 5-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]hexahydro-4-(hydroxymethyl)-(3aS,4S,5R,6aR)-2(1H)-pentalenone |