4-HYDROXY-3-NITRO-5-PROPOXY-BENZALDEHYDE structure
|
Common Name | 4-HYDROXY-3-NITRO-5-PROPOXY-BENZALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 871085-51-7 | Molecular Weight | 225.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-nitro-5-propoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO5 |
|---|---|
| Molecular Weight | 225.19800 |
| Exact Mass | 225.06400 |
| PSA | 92.35000 |
| LogP | 2.42490 |
| InChIKey | XOTMRYLMVFWNPI-UHFFFAOYSA-N |
| SMILES | CCCOc1cc(C=O)cc([N+](=O)[O-])c1O |
| HS Code | 2913000090 |
|---|
|
~100%
4-HYDROXY-3-NIT... CAS#:871085-51-7 |
| Literature: N30 PHARMACEUTICALS, LLC; SUN, Xicheng; QIU, Jian Patent: WO2011/38204 A1, 2011 ; Location in patent: Page/Page column 156 ; WO 2011/038204 A1 |
|
~%
4-HYDROXY-3-NIT... CAS#:871085-51-7 |
| Literature: N30 PHARMACEUTICALS, LLC; SUN, Xicheng; QIU, Jian Patent: WO2011/38204 A1, 2011 ; WO 2011/038204 A1 |
|
~%
4-HYDROXY-3-NIT... CAS#:871085-51-7 |
| Literature: N30 PHARMACEUTICALS, LLC; SUN, Xicheng; QIU, Jian Patent: WO2011/38204 A1, 2011 ; WO 2011/038204 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 4-Hydroxy-3-nitro-5-propoxy-benzaldehyde |
| QC-8495 |