2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid
Modify Date: 2025-09-22 08:40:39
2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid structure
|
Common Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 869947-98-8 | Molecular Weight | 234.29100 | |
| Density | 1.144g/cm3 | Boiling Point | 392ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.9ºC | |
| Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 392ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 146.9ºC |
| Exact Mass | 234.12600 |
| PSA | 46.53000 |
| LogP | 2.80740 |
| Index of Refraction | 1.548 |
| InChIKey | YMERGXVWLWRYGI-UHFFFAOYSA-N |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |