Formoxanthone A
Modify Date: 2025-09-07 19:45:34
Formoxanthone A structure
|
Common Name | Formoxanthone A | ||
|---|---|---|---|---|
| CAS Number | 869880-32-0 | Molecular Weight | 394.417 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 624.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±25.0 °C | |
Use of Formoxanthone AFormoxanthone A is an apoptosis inducing compound that can significantly reduce the viability of HeLa cells at 25 μM[1]. |
| Name | 7,9,12-Trihydroxy-2,2-dimethyl-10-(3-methyl-2-buten-1-yl)-2H,6H-pyrano[3,2-b]xanthen-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Formoxanthone A is an apoptosis inducing compound that can significantly reduce the viability of HeLa cells at 25 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 624.1±55.0 °C at 760 mmHg |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.417 |
| Flash Point | 219.4±25.0 °C |
| Exact Mass | 394.141632 |
| LogP | 4.85 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | KWJOUIWWNNDURW-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)c3cc4c(c(O)c3oc12)OC(C)(C)C=C4 |
| Storage condition | 2-8℃ |
| 2H,6H-Pyrano[3,2-b]xanthen-6-one, 7,9,12-trihydroxy-2,2-dimethyl-10-(3-methyl-2-buten-1-yl)- |
| 7,9,12-Trihydroxy-2,2-dimethyl-10-(3-methyl-2-buten-1-yl)-2H,6H-pyrano[3,2-b]xanthen-6-one |