2,3,4-trimethyl-8-propan-2-ylquinoline structure
|
Common Name | 2,3,4-trimethyl-8-propan-2-ylquinoline | ||
|---|---|---|---|---|
| CAS Number | 86952-78-5 | Molecular Weight | 213.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4-trimethyl-8-propan-2-ylquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19N |
|---|---|
| Molecular Weight | 213.31800 |
| Exact Mass | 213.15200 |
| PSA | 12.89000 |
| LogP | 4.28340 |
| InChIKey | IECWBAZGQUYFIN-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(C(C)C)cccc2c(C)c1C |
|
~%
2,3,4-trimethyl... CAS#:86952-78-5 |
| Literature: Schenck; Bailey Journal of the American Chemical Society, 1941 , vol. 63, p. 1365 |
|
~%
2,3,4-trimethyl... CAS#:86952-78-5 |
| Literature: Schenck; Bailey Journal of the American Chemical Society, 1941 , vol. 63, p. 1365 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 8-isopropyl-2,3,4-trimethyl-quinoline |
| Quinoline,2,3,4-trimethyl-8-(1-methylethyl) |
| 8-Isopropyl-2,3,4-trimethyl-chinolin |