tert-Butyl 4-(4-chloro-2-formylphenyl)tetrahydro-1(2H)-pyrazinecarboxylate
Modify Date: 2025-08-24 17:13:34
tert-Butyl 4-(4-chloro-2-formylphenyl)tetrahydro-1(2H)-pyrazinecarboxylate structure
|
Common Name | tert-Butyl 4-(4-chloro-2-formylphenyl)tetrahydro-1(2H)-pyrazinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 869478-16-0 | Molecular Weight | 324.80300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-(4-chloro-2-formylphenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21ClN2O3 |
|---|---|
| Molecular Weight | 324.80300 |
| Exact Mass | 324.12400 |
| PSA | 49.85000 |
| LogP | 3.21250 |
| InChIKey | QYUKBCDPNJYYKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Cl)cc2C=O)CC1 |
| HS Code | 2933599090 |
|---|
|
~13%
tert-Butyl 4-(4... CAS#:869478-16-0 |
| Literature: Jiang, Wanlong; Chen, Chen; Marinkovic, Dragan; Tran, Joe A.; Chen, Caroline W.; Arellano, L. Melissa; White, Nicole S.; Tucci, Fabio C. Journal of Organic Chemistry, 2005 , vol. 70, # 22 p. 8924 - 8931 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DE-0704 |
| 4-(4-chloro-2-formyl-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| tert-butyl 4-(4-chloro-2-formylphenyl)tetrahydro-1(2H)-pyrazinecarboxylate |
| 2-[4-(tert-butoxycarbonyl)-1-piperazinyl]-5-chlorobenzaldehyde |
| 4-(4-chloro-6-formyl-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |