2-methylsilylethyl(diphenyl)phosphane
Modify Date: 2025-09-26 11:40:30
2-methylsilylethyl(diphenyl)phosphane structure
|
Common Name | 2-methylsilylethyl(diphenyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 86934-63-6 | Molecular Weight | 258.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19PSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylsilylethyl(diphenyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19PSi |
|---|---|
| Molecular Weight | 258.37100 |
| Exact Mass | 258.09900 |
| PSA | 13.59000 |
| LogP | 2.75450 |
| InChIKey | MNPIESIBSFOMAV-UHFFFAOYSA-N |
| SMILES | C[SiH2]CCP(c1ccccc1)c1ccccc1 |
|
~63%
2-methylsilylet... CAS#:86934-63-6 |
| Literature: Holmes-Smith, Rupert D.; Osei, Rexford D.; Stobart, Stephen R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 861 - 866 |
|
~%
2-methylsilylet... CAS#:86934-63-6 |
| Literature: Holmes-Smith, Rupert D.; Osei, Rexford D.; Stobart, Stephen R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 861 - 866 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphine,[2-(methylsilyl)ethyl]diphenyl |