ICI141292
Modify Date: 2025-09-18 23:31:29
ICI141292 structure
|
Common Name | ICI141292 | ||
|---|---|---|---|---|
| CAS Number | 86880-51-5 | Molecular Weight | 369.41400 | |
| Density | 1.28g/cm3 | Boiling Point | 689.7ºC at 760mmHg | |
| Molecular Formula | C20H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370.9ºC | |
Use of ICI141292ICI141292 is a potent β-adrenoceptor partial agonist with a greater affinity for β1- than β2-adrenoceptors. |
| Name | N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | ICI141292 is a potent β-adrenoceptor partial agonist with a greater affinity for β1- than β2-adrenoceptors. |
|---|---|
| Related Catalog | |
| Target |
β1 adrenoceptor[1] |
| In Vitro | ICI141292 (Epanolol) is a novel anti-anginal agent which is a β1-adrenoceptor partial agonist exhibiting selective β1-adrenoceptor antagonist and selective β1-adrenoceptor agonist activity[1]. |
| References |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 689.7ºC at 760mmHg |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.41400 |
| Flash Point | 370.9ºC |
| Exact Mass | 369.16900 |
| PSA | 114.61000 |
| LogP | 1.73388 |
| Index of Refraction | 1.617 |
| InChIKey | YARKMNAWFIMDKV-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1OCC(O)CNCCNC(=O)Cc1ccc(O)cc1 |
| Epanololum [Latin] |
| (+-)-N-(2-((3-(o-Cyanophenoxy)-2-hydroxypropyl)amino)ethyl)-2-(p-hydroxyphenyl)acetamide |
| Visacor |
| Epanololum |
| Benzeneacetamide,N-(2-((3-(2-cyanophenoxy)-2-hydroxypropyl)amino)ethyl)-4-hydroxy |
| Epanolol |
| ICI141292 |