3,4-Dichlorobenzoic anhydride structure
|
Common Name | 3,4-Dichlorobenzoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 86866-14-0 | Molecular Weight | 364.00800 | |
| Density | 1.551g/cm3 | Boiling Point | 499ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 3,4-Dichlorobenzoic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760 mmHg |
| Molecular Formula | C14H6Cl4O3 |
| Molecular Weight | 364.00800 |
| Flash Point | 202.4ºC |
| Exact Mass | 361.90700 |
| PSA | 43.37000 |
| LogP | 5.29740 |
| Index of Refraction | 1.621 |
| InChIKey | JKRVKAAJSJWYFT-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (3,4-dichlorobenzoyl) 3,4-dichlorobenzoate |