3-chloro-2-N,2-N-dimethyl-5-nitropyrazine-2,6-diamine structure
|
Common Name | 3-chloro-2-N,2-N-dimethyl-5-nitropyrazine-2,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 86845-61-6 | Molecular Weight | 217.61300 | |
| Density | 1.554g/cm3 | Boiling Point | 403.9ºC at 760 mmHg | |
| Molecular Formula | C6H8ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 3-chloro-2-N,2-N-dimethyl-5-nitropyrazine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 403.9ºC at 760 mmHg |
| Molecular Formula | C6H8ClN5O2 |
| Molecular Weight | 217.61300 |
| Flash Point | 198.1ºC |
| Exact Mass | 217.03700 |
| PSA | 100.86000 |
| LogP | 1.79080 |
| Index of Refraction | 1.672 |
| InChIKey | QVJZOAKAZCOFRQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(N)c([N+](=O)[O-])nc1Cl |
|
~91%
3-chloro-2-N,2-... CAS#:86845-61-6 |
| Literature: Hartman, George D.; Hartman, Richard D. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1089 - 1092 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chloro-N2,N2-dimethyl-5-nitro-2,6-pyrazinediamine |
| 3-chloro-N,N-dimethyl-5-nitropyrazine-2,6-diamine |
| 2,6-Pyrazinediamine,3-chloro-N2,N2-dimethyl-5-nitro |
| 6-dimethylamino-5-chloro-3-nitropyrazinamine |