N-methoxy-N-[(4-nitrophenyl)diazenyl]methanamine structure
|
Common Name | N-methoxy-N-[(4-nitrophenyl)diazenyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 86796-96-5 | Molecular Weight | 210.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methoxy-N-[(4-nitrophenyl)diazenyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10N4O3 |
|---|---|
| Molecular Weight | 210.19000 |
| Exact Mass | 210.07500 |
| PSA | 83.01000 |
| LogP | 2.60990 |
| InChIKey | IYSHLYRZVGORCR-UHFFFAOYSA-N |
| SMILES | CON(C)N=Nc1ccc([N+](=O)[O-])cc1 |
|
~%
N-methoxy-N-[(4... CAS#:86796-96-5 |
| Literature: Boese; Jones; Major Journal of the American Chemical Society, 1931 , vol. 53, p. 3530,3534 |
|
~%
Detail
|
| Literature: Boese; Jones; Major Journal of the American Chemical Society, 1931 , vol. 53, p. 3530,3534 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-Triazene,3-methoxy-3-methyl-1-(4-nitrophenyl) |
| 3-methoxy-3-methyl-1-(4-nitro-phenyl)-triazene |