1,1-dibenzyl-3-(4-nitrophenyl)urea
Modify Date: 2024-02-18 17:48:31
1,1-dibenzyl-3-(4-nitrophenyl)urea structure
|
Common Name | 1,1-dibenzyl-3-(4-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 86764-73-0 | Molecular Weight | 361.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dibenzyl-3-(4-nitrophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H19N3O3 |
|---|---|
| Molecular Weight | 361.39400 |
| Exact Mass | 361.14300 |
| PSA | 78.16000 |
| LogP | 5.42530 |
| InChIKey | HMWRPGRIRJVVFF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(Cc1ccccc1)Cc1ccccc1 |
|
~42%
1,1-dibenzyl-3-... CAS#:86764-73-0 |
| Literature: Han, Hoon; Chang, Sukbok Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 3 p. 746 - 748 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Urea,N'-(4-nitrophenyl)-N,N-bis(phenylmethyl) |