Dimethyl 2-(pyrimidin-4-yl)malonate
Modify Date: 2025-09-30 19:13:16
Dimethyl 2-(pyrimidin-4-yl)malonate structure
|
Common Name | Dimethyl 2-(pyrimidin-4-yl)malonate | ||
|---|---|---|---|---|
| CAS Number | 86761-91-3 | Molecular Weight | 210.18700 | |
| Density | 1.267g/cm3 | Boiling Point | 295.694ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.631ºC | |
| Name | dimethyl 2-pyrimidin-4-ylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 295.694ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 132.631ºC |
| Exact Mass | 210.06400 |
| PSA | 78.38000 |
| Index of Refraction | 1.508 |
| InChIKey | NGCATIQVQXWDHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)c1ccncn1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| I03-0383 |
| DIMETHYL 2-(PYRIMIDIN-4-YL)MALONATE |
| Propanedioic acid,4-pyrimidinyl-,dimethyl ester |